Molecular Definition

Canonical SMILES O=C1NC=Nc2c(CNCc3occc3)nccc12
Formula C13H12N4O2
Molecular Weight 256.26 da
Stereocenters 0/0