Molecular Definition

Canonical SMILES Nc1nc(cs1)c2cc(ccn2)C(=O)O
Formula C9H7N3O2S
Molecular Weight 221.24 da
Stereocenters 0/0