Molecular Definition

Canonical SMILES CCCOc1cc(OCCCN)cc(Oc2cc3N(C)C(=O)N(C)c3cc2NS(=O)(=O)c4ccc(OC)c(OC)c4)c1
Formula C29H36N4O8S
Molecular Weight 600.68 da
Stereocenters 0/0