Molecular Definition

Canonical SMILES O=C1NC=Nc2c1ccnc2n3cc(CCN4CCC(CC4)c5ccccc5)cn3
Formula C23H24N6O
Molecular Weight 400.48 da
Stereocenters 0/0