Molecular Definition

Canonical SMILES OC(=O)c1ccncc1NCCCc2ccccc2
Formula C15H16N2O2
Molecular Weight 256.30 da
Stereocenters 0/0