Molecular Definition

Canonical SMILES O=C1NC=Nc2c1ccnc2n3cc(CCN4CCC(Cc5ccccc5)CC4)cn3
Formula C24H26N6O
Molecular Weight 414.50 da
Stereocenters 0/0