Molecular Definition

Canonical SMILES Clc1ccccc1OC[C@H]2CC[C@H](N2)C(=O)N3CCC[C@H]3C#N
Formula C17H20ClN3O2
Molecular Weight 333.81 da
Stereocenters 3/3