Molecular Definition

Canonical SMILES CC(=O)c1cc(c2ccccc2CO)c3cc(C)ccn13
Formula C18H17NO2
Molecular Weight 279.33 da
Stereocenters 0/0