Target Relevance

Molecular Definition

Canonical SMILES Cc1nc2c(c(Cl)c(Cl)cc2n1c3ccccc3)[N+](=O)[O-]
Formula C14H9Cl2N3O2
Molecular Weight 322.15 da
Stereocenters 0/0