Molecular Definition

Canonical SMILES CC(=O)c1cc(c2ccccc2S(=O)(=O)C)c3ccccn13
Formula C17H15NO3S
Molecular Weight 313.37 da
Stereocenters 0/0