Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc(Cn2c(C)nc3c(c(Cl)c(Cl)cc23)[N+](=O)[O-])cc1
Formula C17H13Cl2N3O4
Molecular Weight 394.21 da
Stereocenters 0/0