Target Relevance

Molecular Definition

Canonical SMILES Cc1nc2c(c(Cl)c(Cl)cc2n1Cc3ccc(Cl)nc3)[N+](=O)[O-]
Formula C14H9Cl3N4O2
Molecular Weight 371.61 da
Stereocenters 0/0