Molecular Definition

Canonical SMILES CC(=O)c1cc(c2ccccc2S(=O)(=O)C)c3cc(C)ccn13
Formula C18H17NO3S
Molecular Weight 327.40 da
Stereocenters 0/0