Target Relevance

Molecular Definition

Canonical SMILES Cc1nc2c(c(Cl)c(Cl)cc2n1Cc3ccc(cc3)n4cccn4)[N+](=O)[O-]
Formula C18H13Cl2N5O2
Molecular Weight 402.23 da
Stereocenters 0/0