Molecular Definition

Canonical SMILES CC(C)Oc1ccc(cc1C#N)c2nnc(s2)n3nc4CCNCc4c3C
Formula C19H20N6OS
Molecular Weight 380.47 da
Stereocenters 0/0