Target Relevance

Molecular Definition

Canonical SMILES Cc1nc2c(c(Cl)c(Cl)cc2n1Cc3ccc(cc3)n4cccc4)[N+](=O)[O-]
Formula C19H14Cl2N4O2
Molecular Weight 401.25 da
Stereocenters 0/0