Molecular Definition

Canonical SMILES CC(=O)c1cc(c2ccccc2S(=O)(=O)C)c3cc(Oc4ccccc4)ccn13
Formula C23H19NO4S
Molecular Weight 405.47 da
Stereocenters 0/0