Molecular Definition

Canonical SMILES COc1ccc(Oc2cc3N(C)C(=O)N(C)c3cc2NS(=O)(=O)c4ccccc4)cc1
Formula C22H21N3O5S
Molecular Weight 439.48 da
Stereocenters 0/0