Molecular Definition

Canonical SMILES COc1ccn2c(cc(c3ccccc3S(=O)(=O)C)c2c1)C(=O)C
Formula C18H17NO4S
Molecular Weight 343.40 da
Stereocenters 0/0