Molecular Definition

Canonical SMILES CC(=O)c1cc(c2ccccc2S(=O)(=O)C)c3cc(CNC(=O)OC(C)(C)C)ccn13
Formula C23H26N2O5S
Molecular Weight 442.53 da
Stereocenters 0/0