Target Relevance

Molecular Definition

Canonical SMILES Cc1nc2c(c(Cl)c(Cl)cc2n1Cc3ccc(C=O)cc3)[N+](=O)[O-]
Formula C16H11Cl2N3O3
Molecular Weight 364.18 da
Stereocenters 0/0