Molecular Definition

Canonical SMILES COc1ccc(cc1OC)S(=O)(=O)Nc2cc3N(C)C(=O)N(C)c3cc2Oc4ccccc4
Formula C23H23N3O6S
Molecular Weight 469.51 da
Stereocenters 0/0