Molecular Definition

Canonical SMILES CC(=O)O.Cn1c(ccc1c2ccc(cc2)C(=N)N)c3ccccc3
Formula C20H21N3O2
Molecular Weight 335.40 da
Stereocenters 0/0