Molecular Definition

Canonical SMILES O=C1NC(=Nc2cnccc12)Oc3cnn(c3)C4CCCC4
Formula C15H15N5O2
Molecular Weight 297.31 da
Stereocenters 0/0