Molecular Definition

Canonical SMILES CC(C)c1ccc(OC2=Nc3cnccc3C(=O)N2)cn1
Formula C15H14N4O2
Molecular Weight 282.30 da
Stereocenters 0/0