Target Relevance

Molecular Definition

Canonical SMILES Cc1nc2cc(Cl)c(Cl)cc2n1Cc3ccc(cc3)B(O)O
Formula C15H13BCl2N2O2
Molecular Weight 334.99 da
Stereocenters 0/0