Molecular Definition

Canonical SMILES OC(=O)CN(C1(CCC1)c2ccc(cc2)c3ccc(Cl)cc3Cl)S(=O)(=O)c4ccc(OC(F)F)cc4
Formula C25H21Cl2F2NO5S
Molecular Weight 556.41 da
Stereocenters 0/0