Target Relevance

Molecular Definition

Canonical SMILES CC(C)c1c(O)c(O)c(C(=O)O)c2cc(ccc12)c3cc4c(C(=O)O)c(O)c(O)c(C(C)C)c4cc3C
Formula C29H28O8
Molecular Weight 504.53 da
Stereocenters 0/0