Molecular Definition

Canonical SMILES COc1ncc(c(OC)n1)c2ccc3c(Nc4cc(cc(c4)C(=O)O)C5CCCC5)c(cnc3c2)S(=O)(=O)NC6CC6
Formula C30H31N5O6S
Molecular Weight 589.66 da
Stereocenters 0/0