Molecular Definition

Canonical SMILES CC1(C)CCc2cc(ccc2O1)S(=O)(=O)N(CC(=O)O)C3(CCC3)c4cccc(c4)c5cc(Cl)cc(Cl)c5
Formula C29H29Cl2NO5S
Molecular Weight 574.52 da
Stereocenters 0/0