Molecular Definition

Canonical SMILES NS(=O)(=O)c1ccc(cc1)\N=C\c2ccccc2O
Formula C13H12N2O3S
Molecular Weight 276.31 da
Stereocenters 0/0