Molecular Definition

Canonical SMILES CC(C)c1cccc(OCCN2C3CCC2CC(C3)NS(=O)(=O)c4ccc(F)c(F)c4)c1
Formula C24H30F2N2O3S
Molecular Weight 464.57 da
Stereocenters 0/2