Molecular Definition

Canonical SMILES CC(C)Oc1ncc(cc1Cl)c2nnc(s2)c3cc(F)c(OC[C@H](N)CO)cc3Cl
Formula C19H19Cl2FN4O3S
Molecular Weight 473.35 da
Stereocenters 1/1