Molecular Definition

Canonical SMILES Nc1ncc(cn1)c2cnc(N)c(c2)c3ccc(Cl)cc3
Formula C15H12ClN5
Molecular Weight 297.74 da
Stereocenters 0/0