Molecular Definition

Canonical SMILES COc1ccc(CCNC(=O)CNC(=O)c2ccc(C)s2)cc1OC
Formula C18H22N2O4S
Molecular Weight 362.44 da
Stereocenters 0/0