Molecular Definition

Canonical SMILES C=CCN(CCc1c[nH]c2ccccc12)CC=C
Formula C16H20N2
Molecular Weight 240.34 da
Stereocenters 0/0