Target Relevance

Molecular Definition

Canonical SMILES OC(=O)CCNc1nc(cc(n1)c2nccs2)N3CCN(CC3)c4ccc(F)cc4
Formula C20H21FN6O2S
Molecular Weight 428.48 da
Stereocenters 0/0