Target Relevance

Molecular Definition

Canonical SMILES CC(C)Nc1cc(cc(C)n1)c2nnc(s2)c3cc(F)c(OC[C@H]4COC(=O)N4)cc3Cl
Formula C21H21ClFN5O3S
Molecular Weight 477.94 da
Stereocenters 1/1