Target Relevance

Molecular Definition

Canonical SMILES C[C@H](Nc1cc(nc(n1)n2cnc3ccc(cc23)C#N)c4cocc4)c5ccccc5
Formula C24H18N6O
Molecular Weight 406.44 da
Stereocenters 1/1