Molecular Definition

Canonical SMILES OC(=O)C1(CCC1)Sc2ccnc3ccc(cc23)C4CC4
Formula C17H17NO2S
Molecular Weight 299.39 da
Stereocenters 0/0