Molecular Definition

Canonical SMILES O[C@H]1CCCC[C@@H]1NC(=O)c2cn(Cc3ccc(cc3)n4cccn4)c5cccnc25
Formula C24H25N5O2
Molecular Weight 415.49 da
Stereocenters 2/2