Target Relevance

Molecular Definition

Canonical SMILES O=C(NCCCCCc1ccccc1)N2C(=O)Oc3ccccc23
Formula C19H20N2O3
Molecular Weight 324.37 da
Stereocenters 0/0