Target Relevance

Molecular Definition

Canonical SMILES O=C(NCCc1ccccc1)N2C(=O)Oc3ccccc23
Formula C16H14N2O3
Molecular Weight 282.29 da
Stereocenters 0/0