Target Relevance

Molecular Definition

Canonical SMILES O=C(NCCSCc1ccccc1)N2C(=O)Oc3ccccc23
Formula C17H16N2O3S
Molecular Weight 328.39 da
Stereocenters 0/0