Molecular Definition

Canonical SMILES CCCn1nnc(n1)c2onc(O)c2CC(N)C(=O)O
Formula C10H14N6O4
Molecular Weight 282.26 da
Stereocenters 0/1