Molecular Definition

Canonical SMILES CCc1oc(nn1)c2cn3ncnc(Nc4cc(C(=O)NOC)c(F)cc4F)c3c2C(C)C
Formula C21H21F2N7O3
Molecular Weight 457.43 da
Stereocenters 0/0