Target Relevance

Molecular Definition

Canonical SMILES CC1CCC(CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F
Formula C21H26F3N5O
Molecular Weight 421.46 da
Stereocenters 0/0