Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)C(=O)NC[C@@H]1CC[C@@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F
Formula C23H26F6N6O2
Molecular Weight 532.48 da
Stereocenters 2/2