Target Relevance

Molecular Definition

Canonical SMILES CC(O)[C@@H]1CC[C@@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F
Formula C22H28F3N5O2
Molecular Weight 451.49 da
Stereocenters 2/3