Target Relevance

Molecular Definition

Canonical SMILES CC(=C)C(O)[C@@H]1CC[C@@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F
Formula C24H30F3N5O2
Molecular Weight 477.52 da
Stereocenters 2/3